C13H24N2O5 — CID 104964489
(2S,3R)-2-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-hydroxybutanoic acid (PubChem CID 104964489) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is (2S,3R)-2-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104964489 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (2S,3R)-2-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)CCCNC(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H24N2O5/c1-8(16)10(11(18)19)15-9(17)6-5-7-14-12(20)13(2,3)4/h8,10,16H,5-7H2,1-4H3,(H,14,20)(H,15,17)(H,18,19)/t8-,10+/m1/s1 |
| InChIKey | QZJUAGJVEJECBD-SCZZXKLOSA-N |
| XLogP | -0.12 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|