C11H20BrNO4 — CID 21126350
2-(7-bromoheptanoylamino)-3-hydroxybutanoic acid (PubChem CID 21126350) has the molecular formula C11H20BrNO4 and a molecular weight of 310.19 g/mol. Its IUPAC name is 2-(7-bromoheptanoylamino)-3-hydroxybutanoic acid.
| Compound Name | 2-(7-bromoheptanoylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 21126350 |
| Molecular Formula | C11H20BrNO4 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-(7-bromoheptanoylamino)-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)CCCCCCBr)C(=O)O |
| InChI | InChI=1S/C11H20BrNO4/c1-8(14)10(11(16)17)13-9(15)6-4-2-3-5-7-12/h8,10,14H,2-7H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | HUCCBVJLMLQMOE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|