C21H40N2O6 — CID 141347292
2-[[2-(decanoylamino)-3-hydroxyheptanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 141347292) has the molecular formula C21H40N2O6 and a molecular weight of 416.56 g/mol. Its IUPAC name is 2-[[2-(decanoylamino)-3-hydroxyheptanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-(decanoylamino)-3-hydroxyheptanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 141347292 |
| Molecular Formula | C21H40N2O6 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 2-[[2-(decanoylamino)-3-hydroxyheptanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CCCCCCCCCC(=O)NC(C(=O)NC(C(=O)O)C(C)O)C(O)CCCC |
| InChI | InChI=1S/C21H40N2O6/c1-4-6-8-9-10-11-12-14-17(26)22-19(16(25)13-7-5-2)20(27)23-18(15(3)24)21(28)29/h15-16,18-19,24-25H,4-14H2,1-3H3,(H,22,26)(H,23,27)(H,28,29) |
| InChIKey | QFJXSIKGQZZZNT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|