C11H22N2O3 — CID 55027776
N-[4-[methoxy(methyl)amino]-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 55027776) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is N-[4-[methoxy(methyl)amino]-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[methoxy(methyl)amino]-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 55027776 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | N-[4-[methoxy(methyl)amino]-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | CON(C)C(=O)CCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O3/c1-11(2,3)10(15)12-8-6-7-9(14)13(4)16-5/h6-8H2,1-5H3,(H,12,15) |
| InChIKey | ZVFHJEFSYCGEJV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|