C16H33N3O2 — CID 119659545
N-[4-[(3-amino-4-methylpentyl)-methylamino]-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 119659545) has the molecular formula C16H33N3O2 and a molecular weight of 299.46 g/mol. Its IUPAC name is N-[4-[(3-amino-4-methylpentyl)-methylamino]-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[(3-amino-4-methylpentyl)-methylamino]-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 119659545 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | N-[4-[(3-amino-4-methylpentyl)-methylamino]-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)CCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H33N3O2/c1-12(2)13(17)9-11-19(6)14(20)8-7-10-18-15(21)16(3,4)5/h12-13H,7-11,17H2,1-6H3,(H,18,21) |
| InChIKey | MFGFKUQOUXEOOV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|