C12H27ClN2O — CID 119657793
N-(3-amino-4-methylpentyl)-N-methylpentanamide;hydrochloride (PubChem CID 119657793) has the molecular formula C12H27ClN2O and a molecular weight of 250.81 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methylpentanamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119657793 |
| Molecular Formula | C12H27ClN2O |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methylpentanamide;hydrochloride |
| SMILES | CCCCC(=O)N(C)CCC(N)C(C)C.Cl |
| InChI | InChI=1S/C12H26N2O.ClH/c1-5-6-7-12(15)14(4)9-8-11(13)10(2)3;/h10-11H,5-9,13H2,1-4H3;1H |
| InChIKey | OMWXGAMLWWSLNV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |