C17H28N4O3 — CID 119660058
N-(3-amino-4-methylpentyl)-N-methyl-4-(4-nitroanilino)butanamide (PubChem CID 119660058) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-4-(4-nitroanilino)butanamide.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-4-(4-nitroanilino)butanamide |
|---|---|
| PubChem CID | 119660058 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-4-(4-nitroanilino)butanamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)CCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H28N4O3/c1-13(2)16(18)10-12-20(3)17(22)5-4-11-19-14-6-8-15(9-7-14)21(23)24/h6-9,13,16,19H,4-5,10-12,18H2,1-3H3 |
| InChIKey | FATGZAPOXQFTCW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|