C16H26FN3O3S — CID 119657344
N-(3-amino-4-methylpentyl)-3-[(4-fluorophenyl)sulfonylamino]-N-methylpropanamide (PubChem CID 119657344) has the molecular formula C16H26FN3O3S and a molecular weight of 359.47 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-3-[(4-fluorophenyl)sulfonylamino]-N-methylpropanamide.
| Compound Name | N-(3-amino-4-methylpentyl)-3-[(4-fluorophenyl)sulfonylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 119657344 |
| Molecular Formula | C16H26FN3O3S |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-3-[(4-fluorophenyl)sulfonylamino]-N-methylpropanamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)CCNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H26FN3O3S/c1-12(2)15(18)9-11-20(3)16(21)8-10-19-24(22,23)14-6-4-13(17)5-7-14/h4-7,12,15,19H,8-11,18H2,1-3H3 |
| InChIKey | QEKTXQRVJHBKBQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |