C17H25FN2O2 — CID 119659917
N-(3-amino-4-methylpentyl)-4-(4-fluorophenyl)-N-methyl-4-oxobutanamide (PubChem CID 119659917) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-4-(4-fluorophenyl)-N-methyl-4-oxobutanamide.
| Compound Name | N-(3-amino-4-methylpentyl)-4-(4-fluorophenyl)-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 119659917 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-4-(4-fluorophenyl)-N-methyl-4-oxobutanamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)CCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H25FN2O2/c1-12(2)15(19)10-11-20(3)17(22)9-8-16(21)13-4-6-14(18)7-5-13/h4-7,12,15H,8-11,19H2,1-3H3 |
| InChIKey | FBRGSTPSDAWNJX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |