C20H24N4O6 — CID 58794811
ethyl 2,6-bis(4-nitroanilino)hexanoate (PubChem CID 58794811) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is ethyl 2,6-bis(4-nitroanilino)hexanoate.
| Compound Name | ethyl 2,6-bis(4-nitroanilino)hexanoate |
|---|---|
| PubChem CID | 58794811 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | ethyl 2,6-bis(4-nitroanilino)hexanoate |
| SMILES | CCOC(=O)C(CCCCNc1ccc([N+](=O)[O-])cc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H24N4O6/c1-2-30-20(25)19(22-16-8-12-18(13-9-16)24(28)29)5-3-4-14-21-15-6-10-17(11-7-15)23(26)27/h6-13,19,21-22H,2-5,14H2,1H3 |
| InChIKey | DBSPIOPHRZTOBO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|