C10H16ClN3O2 — CID 11817436
N'-(4-nitrophenyl)butane-1,4-diamine;hydrochloride (PubChem CID 11817436) has the molecular formula C10H16ClN3O2 and a molecular weight of 245.71 g/mol. Its IUPAC name is N'-(4-nitrophenyl)butane-1,4-diamine;hydrochloride.
| Compound Name | N'-(4-nitrophenyl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 11817436 |
| Molecular Formula | C10H16ClN3O2 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N'-(4-nitrophenyl)butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H15N3O2.ClH/c11-7-1-2-8-12-9-3-5-10(6-4-9)13(14)15;/h3-6,12H,1-2,7-8,11H2;1H |
| InChIKey | SUTNXSMGDMGIKN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|