C18H27N3O3 — CID 118234452
(2S)-N'-tert-butyl-2-(3-phenylpropanoylamino)pentanediamide (PubChem CID 118234452) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2S)-N'-tert-butyl-2-(3-phenylpropanoylamino)pentanediamide.
| Compound Name | (2S)-N'-tert-butyl-2-(3-phenylpropanoylamino)pentanediamide |
|---|---|
| PubChem CID | 118234452 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (2S)-N'-tert-butyl-2-(3-phenylpropanoylamino)pentanediamide |
| SMILES | CC(C)(C)NC(=O)CC[C@H](NC(=O)CCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C18H27N3O3/c1-18(2,3)21-16(23)12-10-14(17(19)24)20-15(22)11-9-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H2,19,24)(H,20,22)(H,21,23)/t14-/m0/s1 |
| InChIKey | HYHMAQILHKCVRO-AWEZNQCLSA-N |
| XLogP | 1.28 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |