C26H41N3O5 — CID 158606646
tert-butyl N-[(5S)-8-(tert-butylamino)-4,8-dioxo-5-(3-phenylpropanoylamino)octyl]carbamate (PubChem CID 158606646) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is tert-butyl N-[(5S)-8-(tert-butylamino)-4,8-dioxo-5-(3-phenylpropanoylamino)octyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-8-(tert-butylamino)-4,8-dioxo-5-(3-phenylpropanoylamino)octyl]carbamate |
|---|---|
| PubChem CID | 158606646 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | tert-butyl N-[(5S)-8-(tert-butylamino)-4,8-dioxo-5-(3-phenylpropanoylamino)octyl]carbamate |
| SMILES | CC(C)(C)NC(=O)CC[C@H](NC(=O)CCc1ccccc1)C(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H41N3O5/c1-25(2,3)29-23(32)17-15-20(28-22(31)16-14-19-11-8-7-9-12-19)21(30)13-10-18-27-24(33)34-26(4,5)6/h7-9,11-12,20H,10,13-18H2,1-6H3,(H,27,33)(H,28,31)(H,29,32)/t20-/m0/s1 |
| InChIKey | HWHSMTDPWWXVJK-FQEVSTJZSA-N |
| XLogP | 3.67 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|