C27H27N3O5 — CID 14566783
methyl (2S,4S)-2,4,5-tribenzamidopentanoate (PubChem CID 14566783) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is methyl (2S,4S)-2,4,5-tribenzamidopentanoate.
| Compound Name | methyl (2S,4S)-2,4,5-tribenzamidopentanoate |
|---|---|
| PubChem CID | 14566783 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | methyl (2S,4S)-2,4,5-tribenzamidopentanoate |
| SMILES | COC(=O)[C@H](C[C@@H](CNC(=O)c1ccccc1)NC(=O)c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H27N3O5/c1-35-27(34)23(30-26(33)21-15-9-4-10-16-21)17-22(29-25(32)20-13-7-3-8-14-20)18-28-24(31)19-11-5-2-6-12-19/h2-16,22-23H,17-18H2,1H3,(H,28,31)(H,29,32)(H,30,33)/t22-,23-/m0/s1 |
| InChIKey | YMJHHVZQKGXNHG-GOTSBHOMSA-N |
| XLogP | 2.58 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |