C18H24N2O5S — CID 10110320
methyl (2S)-2-[[(2R)-2-acetylsulfanyl-3-methylbutanoyl]amino]-3-benzamidopropanoate (PubChem CID 10110320) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-acetylsulfanyl-3-methylbutanoyl]amino]-3-benzamidopropanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-acetylsulfanyl-3-methylbutanoyl]amino]-3-benzamidopropanoate |
|---|---|
| PubChem CID | 10110320 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-acetylsulfanyl-3-methylbutanoyl]amino]-3-benzamidopropanoate |
| SMILES | COC(=O)[C@H](CNC(=O)c1ccccc1)NC(=O)[C@H](SC(C)=O)C(C)C |
| InChI | InChI=1S/C18H24N2O5S/c1-11(2)15(26-12(3)21)17(23)20-14(18(24)25-4)10-19-16(22)13-8-6-5-7-9-13/h5-9,11,14-15H,10H2,1-4H3,(H,19,22)(H,20,23)/t14-,15+/m0/s1 |
| InChIKey | RAXCHRKWGGESJJ-LSDHHAIUSA-N |
| XLogP | 1.38 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|