C22H31N3O6S — CID 87515567
methyl (2S)-4-[[(2S)-2-acetylsulfanyl-3-methylbutanoyl]amino]-2-amino-2-(benzamidomethyl)-4-methyl-3-oxopentanoate (PubChem CID 87515567) has the molecular formula C22H31N3O6S and a molecular weight of 465.57 g/mol. Its IUPAC name is methyl (2S)-4-[[(2S)-2-acetylsulfanyl-3-methylbutanoyl]amino]-2-amino-2-(benzamidomethyl)-4-methyl-3-oxopentanoate.
| Compound Name | methyl (2S)-4-[[(2S)-2-acetylsulfanyl-3-methylbutanoyl]amino]-2-amino-2-(benzamidomethyl)-4-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 87515567 |
| Molecular Formula | C22H31N3O6S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | methyl (2S)-4-[[(2S)-2-acetylsulfanyl-3-methylbutanoyl]amino]-2-amino-2-(benzamidomethyl)-4-methyl-3-oxopentanoate |
| SMILES | COC(=O)[C@](N)(CNC(=O)c1ccccc1)C(=O)C(C)(C)NC(=O)[C@@H](SC(C)=O)C(C)C |
| InChI | InChI=1S/C22H31N3O6S/c1-13(2)16(32-14(3)26)18(28)25-21(4,5)19(29)22(23,20(30)31-6)12-24-17(27)15-10-8-7-9-11-15/h7-11,13,16H,12,23H2,1-6H3,(H,24,27)(H,25,28)/t16-,22-/m0/s1 |
| InChIKey | DGMFYHLVTORFMN-AOMKIAJQSA-N |
| XLogP | 1.06 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|