C15H18N2O6 — CID 131842932
dimethyl 2-acetamido-2-(benzamidomethyl)propanedioate (PubChem CID 131842932) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is dimethyl 2-acetamido-2-(benzamidomethyl)propanedioate.
| Compound Name | dimethyl 2-acetamido-2-(benzamidomethyl)propanedioate |
|---|---|
| PubChem CID | 131842932 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | dimethyl 2-acetamido-2-(benzamidomethyl)propanedioate |
| SMILES | COC(=O)C(CNC(=O)c1ccccc1)(NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C15H18N2O6/c1-10(18)17-15(13(20)22-2,14(21)23-3)9-16-12(19)11-7-5-4-6-8-11/h4-8H,9H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | DMPRZFWPOURPON-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|