About N-ethylbenzamide;hydrochloride
N-ethylbenzamide;hydrochloride (PubChem CID 57444995) has the molecular formula C9H12ClNO
and a molecular weight of 185.65 g/mol. Its IUPAC name is N-ethylbenzamide;hydrochloride.
Molecular Properties
| Compound Name | N-ethylbenzamide;hydrochloride |
| PubChem CID | 57444995 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | N-ethylbenzamide;hydrochloride |
| SMILES | CCNC(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C9H11NO.ClH/c1-2-10-9(11)8-6-4-3-5-7-8;/h3-7H,2H2,1H3,(H,10,11);1H |
| InChIKey | YAINPEPNMHHUMK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethylbenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylbenzamide;hydrochloride?
The IUPAC name of N-ethylbenzamide;hydrochloride (CID 57444995) is N-ethylbenzamide;hydrochloride.
What is the SMILES notation for N-ethylbenzamide;hydrochloride?
The canonical SMILES for N-ethylbenzamide;hydrochloride is CCNC(=O)c1ccccc1.Cl.
What is the InChIKey of N-ethylbenzamide;hydrochloride?
The InChIKey is YAINPEPNMHHUMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.ClH/c1-2-10-9(11)8-6-4-3-5-7-8;/h3-7H,2H2,1H3,(H,10,11);1H.
What are the key properties of N-ethylbenzamide;hydrochloride?
N-ethylbenzamide;hydrochloride has a molecular weight of 185.65 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylbenzamide;hydrochloride is sourced from PubChem (CID 57444995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).