C11H9BrF3NO3 — CID 101241069
methyl (2S)-2-benzamido-2-bromo-3,3,3-trifluoropropanoate (PubChem CID 101241069) has the molecular formula C11H9BrF3NO3 and a molecular weight of 340.10 g/mol. Its IUPAC name is methyl (2S)-2-benzamido-2-bromo-3,3,3-trifluoropropanoate.
| Compound Name | methyl (2S)-2-benzamido-2-bromo-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 101241069 |
| Molecular Formula | C11H9BrF3NO3 |
| Molecular Weight | 340.10 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | methyl (2S)-2-benzamido-2-bromo-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)[C@@](Br)(NC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H9BrF3NO3/c1-19-9(18)10(12,11(13,14)15)16-8(17)7-5-3-2-4-6-7/h2-6H,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | IIMHIUKWPXYFBN-SNVBAGLBSA-N |
| XLogP | 2.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.10 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|