C12H13Cl2NO4 — CID 15562203
methyl 2-benzamido-3,3-dichloro-2-methoxypropanoate (PubChem CID 15562203) has the molecular formula C12H13Cl2NO4 and a molecular weight of 306.15 g/mol. Its IUPAC name is methyl 2-benzamido-3,3-dichloro-2-methoxypropanoate.
| Compound Name | methyl 2-benzamido-3,3-dichloro-2-methoxypropanoate |
|---|---|
| PubChem CID | 15562203 |
| Molecular Formula | C12H13Cl2NO4 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | methyl 2-benzamido-3,3-dichloro-2-methoxypropanoate |
| SMILES | COC(=O)C(NC(=O)c1ccccc1)(OC)C(Cl)Cl |
| InChI | InChI=1S/C12H13Cl2NO4/c1-18-11(17)12(19-2,10(13)14)15-9(16)8-6-4-3-5-7-8/h3-7,10H,1-2H3,(H,15,16) |
| InChIKey | SVVDGNBVYMVNID-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|