C23H27NO6 — CID 102275089
dimethyl 2-benzamido-2-(2-methyl-1-phenylmethoxypropyl)propanedioate (PubChem CID 102275089) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is dimethyl 2-benzamido-2-(2-methyl-1-phenylmethoxypropyl)propanedioate.
| Compound Name | dimethyl 2-benzamido-2-(2-methyl-1-phenylmethoxypropyl)propanedioate |
|---|---|
| PubChem CID | 102275089 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | dimethyl 2-benzamido-2-(2-methyl-1-phenylmethoxypropyl)propanedioate |
| SMILES | COC(=O)C(NC(=O)c1ccccc1)(C(=O)OC)C(OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C23H27NO6/c1-16(2)19(30-15-17-11-7-5-8-12-17)23(21(26)28-3,22(27)29-4)24-20(25)18-13-9-6-10-14-18/h5-14,16,19H,15H2,1-4H3,(H,24,25) |
| InChIKey | COCNZZJJTVPEMS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|