C13H18O3 — CID 11096185
methyl (2S)-3-methyl-2-phenylmethoxybutanoate (PubChem CID 11096185) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-phenylmethoxybutanoate.
| Compound Name | methyl (2S)-3-methyl-2-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 11096185 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | methyl (2S)-3-methyl-2-phenylmethoxybutanoate |
| SMILES | COC(=O)[C@@H](OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C13H18O3/c1-10(2)12(13(14)15-3)16-9-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3/t12-/m0/s1 |
| InChIKey | AQWLSBIWGSPJKL-LBPRGKRZSA-N |
| XLogP | 2.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |