C30H32O5 — CID 23244262
methyl (2R,3S,4R,5E)-2,3,4-tris(phenylmethoxy)octa-5,7-dienoate (PubChem CID 23244262) has the molecular formula C30H32O5 and a molecular weight of 472.58 g/mol. Its IUPAC name is methyl (2R,3S,4R,5E)-2,3,4-tris(phenylmethoxy)octa-5,7-dienoate.
| Compound Name | methyl (2R,3S,4R,5E)-2,3,4-tris(phenylmethoxy)octa-5,7-dienoate |
|---|---|
| PubChem CID | 23244262 |
| Molecular Formula | C30H32O5 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | methyl (2R,3S,4R,5E)-2,3,4-tris(phenylmethoxy)octa-5,7-dienoate |
| SMILES | C=C/C=C/[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C30H32O5/c1-3-4-20-27(33-21-24-14-8-5-9-15-24)28(34-22-25-16-10-6-11-17-25)29(30(31)32-2)35-23-26-18-12-7-13-19-26/h3-20,27-29H,1,21-23H2,2H3/b20-4+/t27-,28+,29-/m1/s1 |
| InChIKey | QCBGRSRYZAZCPB-GOSANENVSA-N |
| XLogP | 5.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|