C13H16O2 — CID 151048584
(3E)-2-phenylmethoxyhexa-3,5-dien-1-ol (PubChem CID 151048584) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (3E)-2-phenylmethoxyhexa-3,5-dien-1-ol.
| Compound Name | (3E)-2-phenylmethoxyhexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 151048584 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (3E)-2-phenylmethoxyhexa-3,5-dien-1-ol |
| SMILES | C=C/C=C/C(CO)OCc1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-2-3-9-13(10-14)15-11-12-7-5-4-6-8-12/h2-9,13-14H,1,10-11H2/b9-3+ |
| InChIKey | OZOFZHVKOXBLFD-YCRREMRBSA-N |
| XLogP | 2.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|