C29H30O4 — CID 101049962
(2S,3S,4R,5E)-2,3,4-tris(phenylmethoxy)octa-5,7-dienal (PubChem CID 101049962) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is (2S,3S,4R,5E)-2,3,4-tris(phenylmethoxy)octa-5,7-dienal.
| Compound Name | (2S,3S,4R,5E)-2,3,4-tris(phenylmethoxy)octa-5,7-dienal |
|---|---|
| PubChem CID | 101049962 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (2S,3S,4R,5E)-2,3,4-tris(phenylmethoxy)octa-5,7-dienal |
| SMILES | C=C/C=C/[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H30O4/c1-2-3-19-27(31-21-24-13-7-4-8-14-24)29(33-23-26-17-11-6-12-18-26)28(20-30)32-22-25-15-9-5-10-16-25/h2-20,27-29H,1,21-23H2/b19-3+/t27-,28-,29+/m1/s1 |
| InChIKey | LIXSPXSMHJXSFI-YXCPSXRPSA-N |
| XLogP | 5.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|