C27H30O5 — CID 18610492
(2S,3R,4R,5S)-5-hydroxy-2,3,4-tris(phenylmethoxy)hexanal (PubChem CID 18610492) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is (2S,3R,4R,5S)-5-hydroxy-2,3,4-tris(phenylmethoxy)hexanal.
| Compound Name | (2S,3R,4R,5S)-5-hydroxy-2,3,4-tris(phenylmethoxy)hexanal |
|---|---|
| PubChem CID | 18610492 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (2S,3R,4R,5S)-5-hydroxy-2,3,4-tris(phenylmethoxy)hexanal |
| SMILES | C[C@H](O)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H30O5/c1-21(29)26(31-19-23-13-7-3-8-14-23)27(32-20-24-15-9-4-10-16-24)25(17-28)30-18-22-11-5-2-6-12-22/h2-17,21,25-27,29H,18-20H2,1H3/t21-,25+,26+,27-/m0/s1 |
| InChIKey | KOOJXHLFDULJNO-XVZMSMGLSA-N |
| XLogP | 4.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|