C13H16O4 — CID 11139101
(E,4R,5S)-5-hydroxy-4-phenylmethoxyhex-2-enoic acid (PubChem CID 11139101) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (E,4R,5S)-5-hydroxy-4-phenylmethoxyhex-2-enoic acid.
| Compound Name | (E,4R,5S)-5-hydroxy-4-phenylmethoxyhex-2-enoic acid |
|---|---|
| PubChem CID | 11139101 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (E,4R,5S)-5-hydroxy-4-phenylmethoxyhex-2-enoic acid |
| SMILES | C[C@H](O)[C@@H](/C=C/C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C13H16O4/c1-10(14)12(7-8-13(15)16)17-9-11-5-3-2-4-6-11/h2-8,10,12,14H,9H2,1H3,(H,15,16)/b8-7+/t10-,12+/m0/s1 |
| InChIKey | RUNJJEVBPWLQNK-PXYQHZOESA-N |
| XLogP | 1.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|