C17H24O4 — CID 101460946
ethyl (E,4R,5R)-5-hydroxy-4-phenylmethoxyoct-2-enoate (PubChem CID 101460946) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl (E,4R,5R)-5-hydroxy-4-phenylmethoxyoct-2-enoate.
| Compound Name | ethyl (E,4R,5R)-5-hydroxy-4-phenylmethoxyoct-2-enoate |
|---|---|
| PubChem CID | 101460946 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | ethyl (E,4R,5R)-5-hydroxy-4-phenylmethoxyoct-2-enoate |
| SMILES | CCC[C@@H](O)[C@@H](/C=C/C(=O)OCC)OCc1ccccc1 |
| InChI | InChI=1S/C17H24O4/c1-3-8-15(18)16(11-12-17(19)20-4-2)21-13-14-9-6-5-7-10-14/h5-7,9-12,15-16,18H,3-4,8,13H2,1-2H3/b12-11+/t15-,16-/m1/s1 |
| InChIKey | NLTWVOCZRPKPNW-NFGWICIOSA-N |
| XLogP | 2.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|