C30H32O6 — CID 11488687
ethyl (Z,4R,5S)-6-oxo-4,5,7-tris(phenylmethoxy)hept-2-enoate (PubChem CID 11488687) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is ethyl (Z,4R,5S)-6-oxo-4,5,7-tris(phenylmethoxy)hept-2-enoate.
| Compound Name | ethyl (Z,4R,5S)-6-oxo-4,5,7-tris(phenylmethoxy)hept-2-enoate |
|---|---|
| PubChem CID | 11488687 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | ethyl (Z,4R,5S)-6-oxo-4,5,7-tris(phenylmethoxy)hept-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C30H32O6/c1-2-34-29(32)19-18-28(35-21-25-14-8-4-9-15-25)30(36-22-26-16-10-5-11-17-26)27(31)23-33-20-24-12-6-3-7-13-24/h3-19,28,30H,2,20-23H2,1H3/b19-18-/t28-,30-/m1/s1 |
| InChIKey | BTNNHOVCLJMXRB-ORPOQPARSA-N |
| XLogP | 5.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|