C15H20O3 — CID 11253675
ethyl (Z,4R)-4-methyl-5-phenylmethoxypent-2-enoate (PubChem CID 11253675) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is ethyl (Z,4R)-4-methyl-5-phenylmethoxypent-2-enoate.
| Compound Name | ethyl (Z,4R)-4-methyl-5-phenylmethoxypent-2-enoate |
|---|---|
| PubChem CID | 11253675 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | ethyl (Z,4R)-4-methyl-5-phenylmethoxypent-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-3-18-15(16)10-9-13(2)11-17-12-14-7-5-4-6-8-14/h4-10,13H,3,11-12H2,1-2H3/b10-9-/t13-/m1/s1 |
| InChIKey | FDXBHIQEVCGYKB-ASCRHOAZSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|