C29H33NO5 — CID 102178394
ethyl (E,4R,5R)-5-(4-methoxyanilino)-4,6-bis(phenylmethoxy)hex-2-enoate (PubChem CID 102178394) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is ethyl (E,4R,5R)-5-(4-methoxyanilino)-4,6-bis(phenylmethoxy)hex-2-enoate.
| Compound Name | ethyl (E,4R,5R)-5-(4-methoxyanilino)-4,6-bis(phenylmethoxy)hex-2-enoate |
|---|---|
| PubChem CID | 102178394 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | ethyl (E,4R,5R)-5-(4-methoxyanilino)-4,6-bis(phenylmethoxy)hex-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](OCc1ccccc1)[C@@H](COCc1ccccc1)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H33NO5/c1-3-34-29(31)19-18-28(35-21-24-12-8-5-9-13-24)27(22-33-20-23-10-6-4-7-11-23)30-25-14-16-26(32-2)17-15-25/h4-19,27-28,30H,3,20-22H2,1-2H3/b19-18+/t27-,28-/m1/s1 |
| InChIKey | BHBOZLUXPTYAIY-TXHQWTHFSA-N |
| XLogP | 5.40 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|