C19H26O5 — CID 87287062
ethyl (E,4R,5R)-5-[(4-methoxyphenyl)methoxy]-4-methyl-8-oxooct-2-enoate (PubChem CID 87287062) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is ethyl (E,4R,5R)-5-[(4-methoxyphenyl)methoxy]-4-methyl-8-oxooct-2-enoate.
| Compound Name | ethyl (E,4R,5R)-5-[(4-methoxyphenyl)methoxy]-4-methyl-8-oxooct-2-enoate |
|---|---|
| PubChem CID | 87287062 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | ethyl (E,4R,5R)-5-[(4-methoxyphenyl)methoxy]-4-methyl-8-oxooct-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C)[C@@H](CCC=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H26O5/c1-4-23-19(21)12-7-15(2)18(6-5-13-20)24-14-16-8-10-17(22-3)11-9-16/h7-13,15,18H,4-6,14H2,1-3H3/b12-7+/t15-,18-/m1/s1 |
| InChIKey | CQYPNDATXQVIOU-XHUSSOBZSA-N |
| XLogP | 3.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|