C15H20O4 — CID 53380978
ethyl (Z,4S)-4-[(4-methoxyphenyl)methoxy]pent-2-enoate (PubChem CID 53380978) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is ethyl (Z,4S)-4-[(4-methoxyphenyl)methoxy]pent-2-enoate.
| Compound Name | ethyl (Z,4S)-4-[(4-methoxyphenyl)methoxy]pent-2-enoate |
|---|---|
| PubChem CID | 53380978 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | ethyl (Z,4S)-4-[(4-methoxyphenyl)methoxy]pent-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@H](C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H20O4/c1-4-18-15(16)10-5-12(2)19-11-13-6-8-14(17-3)9-7-13/h5-10,12H,4,11H2,1-3H3/b10-5-/t12-/m0/s1 |
| InChIKey | FWKQELCZJOCLEA-JSJZCHLLSA-N |
| XLogP | 2.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|