C20H30O5 — CID 15449658
ethyl (E,5S,6S,7R)-6-hydroxy-8-[(4-methoxyphenyl)methoxy]-5,7-dimethyloct-2-enoate (PubChem CID 15449658) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is ethyl (E,5S,6S,7R)-6-hydroxy-8-[(4-methoxyphenyl)methoxy]-5,7-dimethyloct-2-enoate.
| Compound Name | ethyl (E,5S,6S,7R)-6-hydroxy-8-[(4-methoxyphenyl)methoxy]-5,7-dimethyloct-2-enoate |
|---|---|
| PubChem CID | 15449658 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | ethyl (E,5S,6S,7R)-6-hydroxy-8-[(4-methoxyphenyl)methoxy]-5,7-dimethyloct-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H](C)[C@H](O)[C@H](C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H30O5/c1-5-25-19(21)8-6-7-15(2)20(22)16(3)13-24-14-17-9-11-18(23-4)12-10-17/h6,8-12,15-16,20,22H,5,7,13-14H2,1-4H3/b8-6+/t15-,16+,20-/m0/s1 |
| InChIKey | MVTTUJMQEAZEEY-VXDHIFSYSA-N |
| XLogP | 3.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|