C15H22O4 — CID 10491992
(2R,3R,4R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal (PubChem CID 10491992) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2R,3R,4R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal.
| Compound Name | (2R,3R,4R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal |
|---|---|
| PubChem CID | 10491992 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (2R,3R,4R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal |
| SMILES | COc1ccc(COC[C@@H](C)[C@@H](O)[C@@H](C)C=O)cc1 |
| InChI | InChI=1S/C15H22O4/c1-11(8-16)15(17)12(2)9-19-10-13-4-6-14(18-3)7-5-13/h4-8,11-12,15,17H,9-10H2,1-3H3/t11-,12+,15-/m0/s1 |
| InChIKey | IZKIRTVEEBPCEY-ZOWXZIJZSA-N |
| XLogP | 2.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|