C15H22O3 — CID 11118487
(2S,3S)-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal (PubChem CID 11118487) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S,3S)-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal.
| Compound Name | (2S,3S)-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal |
|---|---|
| PubChem CID | 11118487 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2S,3S)-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal |
| SMILES | COc1ccc(CO[C@@H](C(C)C)[C@H](C)C=O)cc1 |
| InChI | InChI=1S/C15H22O3/c1-11(2)15(12(3)9-16)18-10-13-5-7-14(17-4)8-6-13/h5-9,11-12,15H,10H2,1-4H3/t12-,15+/m1/s1 |
| InChIKey | FVCUTAVIMQHQSJ-DOMZBBRYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|