C17H24O3 — CID 11346435
(E,4S,5S)-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylhept-2-enal (PubChem CID 11346435) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (E,4S,5S)-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylhept-2-enal.
| Compound Name | (E,4S,5S)-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylhept-2-enal |
|---|---|
| PubChem CID | 11346435 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (E,4S,5S)-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylhept-2-enal |
| SMILES | COc1ccc(CO[C@@H](C(C)C)[C@@H](C)/C=C/C=O)cc1 |
| InChI | InChI=1S/C17H24O3/c1-13(2)17(14(3)6-5-11-18)20-12-15-7-9-16(19-4)10-8-15/h5-11,13-14,17H,12H2,1-4H3/b6-5+/t14-,17-/m0/s1 |
| InChIKey | YXSGEPBMUMROJJ-WVBURXTLSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|