C21H28O6 — CID 121460426
(2S,3S,4S)-2,3-bis[(4-methoxyphenyl)methoxy]pentane-1,4-diol (PubChem CID 121460426) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (2S,3S,4S)-2,3-bis[(4-methoxyphenyl)methoxy]pentane-1,4-diol.
| Compound Name | (2S,3S,4S)-2,3-bis[(4-methoxyphenyl)methoxy]pentane-1,4-diol |
|---|---|
| PubChem CID | 121460426 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (2S,3S,4S)-2,3-bis[(4-methoxyphenyl)methoxy]pentane-1,4-diol |
| SMILES | COc1ccc(CO[C@@H]([C@H](C)O)[C@H](CO)OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H28O6/c1-15(23)21(27-14-17-6-10-19(25-3)11-7-17)20(12-22)26-13-16-4-8-18(24-2)9-5-16/h4-11,15,20-23H,12-14H2,1-3H3/t15-,20-,21-/m0/s1 |
| InChIKey | UTISFDWDMBOBKJ-JHVJFLLYSA-N |
| XLogP | 2.55 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |