C18H22O3 — CID 121462720
(2S,3R)-3-[(4-methoxyphenyl)methoxy]-4-phenylbutan-2-ol (PubChem CID 121462720) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (2S,3R)-3-[(4-methoxyphenyl)methoxy]-4-phenylbutan-2-ol.
| Compound Name | (2S,3R)-3-[(4-methoxyphenyl)methoxy]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 121462720 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (2S,3R)-3-[(4-methoxyphenyl)methoxy]-4-phenylbutan-2-ol |
| SMILES | COc1ccc(CO[C@H](Cc2ccccc2)[C@H](C)O)cc1 |
| InChI | InChI=1S/C18H22O3/c1-14(19)18(12-15-6-4-3-5-7-15)21-13-16-8-10-17(20-2)11-9-16/h3-11,14,18-19H,12-13H2,1-2H3/t14-,18+/m0/s1 |
| InChIKey | RBTAGOPHGLQNBF-KBXCAEBGSA-N |
| XLogP | 3.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |