C19H24O3 — CID 134864557
(3S,4R)-4-[(4-methoxyphenyl)methoxy]-3-methyl-4-phenylbutan-2-ol (PubChem CID 134864557) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3S,4R)-4-[(4-methoxyphenyl)methoxy]-3-methyl-4-phenylbutan-2-ol.
| Compound Name | (3S,4R)-4-[(4-methoxyphenyl)methoxy]-3-methyl-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 134864557 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (3S,4R)-4-[(4-methoxyphenyl)methoxy]-3-methyl-4-phenylbutan-2-ol |
| SMILES | COc1ccc(CO[C@@H](c2ccccc2)[C@@H](C)C(C)O)cc1 |
| InChI | InChI=1S/C19H24O3/c1-14(15(2)20)19(17-7-5-4-6-8-17)22-13-16-9-11-18(21-3)12-10-16/h4-12,14-15,19-20H,13H2,1-3H3/t14-,15?,19+/m0/s1 |
| InChIKey | WPPOAUVSPUAXPC-CTHAPGQVSA-N |
| XLogP | 3.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |