C30H26O5 — CID 12060217
[(1R,2R)-2-[(4-methoxyphenyl)methoxy]-1,2-diphenylethyl] 2-oxo-2-phenylacetate (PubChem CID 12060217) has the molecular formula C30H26O5 and a molecular weight of 466.53 g/mol. Its IUPAC name is [(1R,2R)-2-[(4-methoxyphenyl)methoxy]-1,2-diphenylethyl] 2-oxo-2-phenylacetate.
| Compound Name | [(1R,2R)-2-[(4-methoxyphenyl)methoxy]-1,2-diphenylethyl] 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 12060217 |
| Molecular Formula | C30H26O5 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | [(1R,2R)-2-[(4-methoxyphenyl)methoxy]-1,2-diphenylethyl] 2-oxo-2-phenylacetate |
| SMILES | COc1ccc(CO[C@H](c2ccccc2)[C@H](OC(=O)C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26O5/c1-33-26-19-17-22(18-20-26)21-34-28(24-13-7-3-8-14-24)29(25-15-9-4-10-16-25)35-30(32)27(31)23-11-5-2-6-12-23/h2-20,28-29H,21H2,1H3/t28-,29-/m1/s1 |
| InChIKey | DOKXJACHPSFFAW-FQLXRVMXSA-N |
| XLogP | 6.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|