C29H19F5O4 — CID 12060220
[(1R,2R)-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1,2-diphenylethyl] 2-oxo-2-phenylacetate (PubChem CID 12060220) has the molecular formula C29H19F5O4 and a molecular weight of 526.46 g/mol. Its IUPAC name is [(1R,2R)-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1,2-diphenylethyl] 2-oxo-2-phenylacetate.
| Compound Name | [(1R,2R)-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1,2-diphenylethyl] 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 12060220 |
| Molecular Formula | C29H19F5O4 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | [(1R,2R)-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1,2-diphenylethyl] 2-oxo-2-phenylacetate |
| SMILES | O=C(O[C@H](c1ccccc1)[C@H](OCc1c(F)c(F)c(F)c(F)c1F)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H19F5O4/c30-21-20(22(31)24(33)25(34)23(21)32)16-37-27(18-12-6-2-7-13-18)28(19-14-8-3-9-15-19)38-29(36)26(35)17-10-4-1-5-11-17/h1-15,27-28H,16H2/t27-,28-/m1/s1 |
| InChIKey | ISELGGYRDOGNRZ-VSGBNLITSA-N |
| XLogP | 6.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|