C32H30O4 — CID 14434324
2,3-bis[(4-methoxyphenyl)methyl]-1,4-diphenylbutane-1,4-dione (PubChem CID 14434324) has the molecular formula C32H30O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 2,3-bis[(4-methoxyphenyl)methyl]-1,4-diphenylbutane-1,4-dione.
| Compound Name | 2,3-bis[(4-methoxyphenyl)methyl]-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 14434324 |
| Molecular Formula | C32H30O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 2,3-bis[(4-methoxyphenyl)methyl]-1,4-diphenylbutane-1,4-dione |
| SMILES | COc1ccc(CC(C(=O)c2ccccc2)C(Cc2ccc(OC)cc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H30O4/c1-35-27-17-13-23(14-18-27)21-29(31(33)25-9-5-3-6-10-25)30(32(34)26-11-7-4-8-12-26)22-24-15-19-28(36-2)20-16-24/h3-20,29-30H,21-22H2,1-2H3 |
| InChIKey | ZBNOVYFMRYTVMQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |