C24H24O2 — CID 139118862
(2S,3S)-3-(4-methoxyphenyl)-2-methyl-1,4-diphenylbutan-1-one (PubChem CID 139118862) has the molecular formula C24H24O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is (2S,3S)-3-(4-methoxyphenyl)-2-methyl-1,4-diphenylbutan-1-one.
| Compound Name | (2S,3S)-3-(4-methoxyphenyl)-2-methyl-1,4-diphenylbutan-1-one |
|---|---|
| PubChem CID | 139118862 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2S,3S)-3-(4-methoxyphenyl)-2-methyl-1,4-diphenylbutan-1-one |
| SMILES | COc1ccc([C@@H](Cc2ccccc2)[C@H](C)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24O2/c1-18(24(25)21-11-7-4-8-12-21)23(17-19-9-5-3-6-10-19)20-13-15-22(26-2)16-14-20/h3-16,18,23H,17H2,1-2H3/t18-,23-/m0/s1 |
| InChIKey | WWCREMBDPTWLNU-MBSDFSHPSA-N |
| XLogP | 5.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |