C22H28O3 — CID 162393497
(4S,8S)-8-[(4-methoxyphenyl)methoxy]-8-phenyloct-1-en-4-ol (PubChem CID 162393497) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (4S,8S)-8-[(4-methoxyphenyl)methoxy]-8-phenyloct-1-en-4-ol.
| Compound Name | (4S,8S)-8-[(4-methoxyphenyl)methoxy]-8-phenyloct-1-en-4-ol |
|---|---|
| PubChem CID | 162393497 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (4S,8S)-8-[(4-methoxyphenyl)methoxy]-8-phenyloct-1-en-4-ol |
| SMILES | C=CC[C@@H](O)CCC[C@H](OCc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O3/c1-3-8-20(23)11-7-12-22(19-9-5-4-6-10-19)25-17-18-13-15-21(24-2)16-14-18/h3-6,9-10,13-16,20,22-23H,1,7-8,11-12,17H2,2H3/t20-,22+/m1/s1 |
| InChIKey | VXNBURQGAQBBIQ-IRLDBZIGSA-N |
| XLogP | 5.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|