C13H18O3 — CID 11673005
(2R)-2-[(4-methoxyphenyl)methoxy]pent-4-en-1-ol (PubChem CID 11673005) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (2R)-2-[(4-methoxyphenyl)methoxy]pent-4-en-1-ol.
| Compound Name | (2R)-2-[(4-methoxyphenyl)methoxy]pent-4-en-1-ol |
|---|---|
| PubChem CID | 11673005 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2R)-2-[(4-methoxyphenyl)methoxy]pent-4-en-1-ol |
| SMILES | C=CC[C@H](CO)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H18O3/c1-3-4-13(9-14)16-10-11-5-7-12(15-2)8-6-11/h3,5-8,13-14H,1,4,9-10H2,2H3/t13-/m1/s1 |
| InChIKey | VQUBFINRHDQFSQ-CYBMUJFWSA-N |
| XLogP | 2.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|