C29H49NO5Si — CID 101411245
(3S)-4-hydroxy-3-[(2S,3R,4S)-4-[(4-methoxyphenyl)methoxy]-2-methyl-1-tri(propan-2-yl)silyloxyhept-6-en-3-yl]oxybutanenitrile (PubChem CID 101411245) has the molecular formula C29H49NO5Si and a molecular weight of 519.80 g/mol. Its IUPAC name is (3S)-4-hydroxy-3-[(2S,3R,4S)-4-[(4-methoxyphenyl)methoxy]-2-methyl-1-tri(propan-2-yl)silyloxyhept-6-en-3-yl]oxybutanenitrile.
| Compound Name | (3S)-4-hydroxy-3-[(2S,3R,4S)-4-[(4-methoxyphenyl)methoxy]-2-methyl-1-tri(propan-2-yl)silyloxyhept-6-en-3-yl]oxybutanenitrile |
|---|---|
| PubChem CID | 101411245 |
| Molecular Formula | C29H49NO5Si |
| Molecular Weight | 519.80 g/mol |
| Exact Mass | 519.34 |
| IUPAC Name | (3S)-4-hydroxy-3-[(2S,3R,4S)-4-[(4-methoxyphenyl)methoxy]-2-methyl-1-tri(propan-2-yl)silyloxyhept-6-en-3-yl]oxybutanenitrile |
| SMILES | C=CC[C@H](OCc1ccc(OC)cc1)[C@H](O[C@H](CO)CC#N)[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H49NO5Si/c1-10-11-28(33-20-25-12-14-26(32-9)15-13-25)29(35-27(18-31)16-17-30)24(8)19-34-36(21(2)3,22(4)5)23(6)7/h10,12-15,21-24,27-29,31H,1,11,16,18-20H2,2-9H3/t24-,27-,28-,29+/m0/s1 |
| InChIKey | JUARJOIYIYABET-HSNHEXMOSA-N |
| XLogP | 6.64 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.80 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|