C25H42O5Si — CID 24905826
methyl (E,5R)-5-[(4-methoxyphenyl)methoxy]-7-tri(propan-2-yl)silyloxyhept-2-enoate (PubChem CID 24905826) has the molecular formula C25H42O5Si and a molecular weight of 450.69 g/mol. Its IUPAC name is methyl (E,5R)-5-[(4-methoxyphenyl)methoxy]-7-tri(propan-2-yl)silyloxyhept-2-enoate.
| Compound Name | methyl (E,5R)-5-[(4-methoxyphenyl)methoxy]-7-tri(propan-2-yl)silyloxyhept-2-enoate |
|---|---|
| PubChem CID | 24905826 |
| Molecular Formula | C25H42O5Si |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | methyl (E,5R)-5-[(4-methoxyphenyl)methoxy]-7-tri(propan-2-yl)silyloxyhept-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H](CCO[Si](C(C)C)(C(C)C)C(C)C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H42O5Si/c1-19(2)31(20(3)4,21(5)6)30-17-16-24(10-9-11-25(26)28-8)29-18-22-12-14-23(27-7)15-13-22/h9,11-15,19-21,24H,10,16-18H2,1-8H3/b11-9+/t24-/m1/s1 |
| InChIKey | ZZYFGOCORDOSLT-KMEWNKIWSA-N |
| XLogP | 6.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|