C21H34O5Si — CID 11234824
methyl (E,5R)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]hex-2-enoate (PubChem CID 11234824) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is methyl (E,5R)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]hex-2-enoate.
| Compound Name | methyl (E,5R)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]hex-2-enoate |
|---|---|
| PubChem CID | 11234824 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | methyl (E,5R)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]hex-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H](CO[Si](C)(C)C(C)(C)C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H34O5Si/c1-21(2,3)27(6,7)26-16-19(9-8-10-20(22)24-5)25-15-17-11-13-18(23-4)14-12-17/h8,10-14,19H,9,15-16H2,1-7H3/b10-8+/t19-/m1/s1 |
| InChIKey | MWUJRAXXLHBEPY-LHUXKHBRSA-N |
| XLogP | 4.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|