C17H24O5 — CID 11077714
[(2R)-2-[(4-methoxyphenyl)methoxy]-4-oxobutyl] 2,2-dimethylpropanoate (PubChem CID 11077714) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(2R)-2-[(4-methoxyphenyl)methoxy]-4-oxobutyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-2-[(4-methoxyphenyl)methoxy]-4-oxobutyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11077714 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(2R)-2-[(4-methoxyphenyl)methoxy]-4-oxobutyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(CO[C@H](CC=O)COC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H24O5/c1-17(2,3)16(19)22-12-15(9-10-18)21-11-13-5-7-14(20-4)8-6-13/h5-8,10,15H,9,11-12H2,1-4H3/t15-/m1/s1 |
| InChIKey | RATPLMPSFWWZKV-OAHLLOKOSA-N |
| XLogP | 2.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|